C27H25F2NO5 — CID 154199857
3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 154199857) has the molecular formula C27H25F2NO5 and a molecular weight of 481.50 g/mol. Its IUPAC name is 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 154199857 |
| Molecular Formula | C27H25F2NO5 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=Cc2cc(F)c(OC)c(NC=CC(=O)c3cccc(F)c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25F2NO5/c1-32-24-14-18(15-25(33-2)27(24)35-4)9-8-17-12-21(29)26(34-3)22(13-17)30-11-10-23(31)19-6-5-7-20(28)16-19/h5-16,30H,1-4H3 |
| InChIKey | AXXJPXIRTQWAPV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|