C28H30FNO6 — CID 134378486
(Z)-3-[2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 134378486) has the molecular formula C28H30FNO6 and a molecular weight of 495.55 g/mol. Its IUPAC name is (Z)-3-[2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-[2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134378486 |
| Molecular Formula | C28H30FNO6 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (Z)-3-[2,3-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(CCc2cc(OC)c(OC)c(OC)c2)cc(N/C=C\C(=O)c2cccc(F)c2)c1OC |
| InChI | InChI=1S/C28H30FNO6/c1-32-24-14-18(9-10-19-15-25(33-2)28(36-5)26(16-19)34-3)13-22(27(24)35-4)30-12-11-23(31)20-7-6-8-21(29)17-20/h6-8,11-17,30H,9-10H2,1-5H3/b12-11- |
| InChIKey | AMDBRGYWFUXGNW-QXMHVHEDSA-N |
| XLogP | 5.46 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|