C27H29NO6 — CID 134378132
(Z)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]prop-2-en-1-one (PubChem CID 134378132) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is (Z)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]prop-2-en-1-one.
| Compound Name | (Z)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 134378132 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (Z)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C\Nc2cccc(CCc3cc(OC)c(OC)c(OC)c3)c2)cc1O |
| InChI | InChI=1S/C27H29NO6/c1-31-24-11-10-20(17-23(24)30)22(29)12-13-28-21-7-5-6-18(14-21)8-9-19-15-25(32-2)27(34-4)26(16-19)33-3/h5-7,10-17,28,30H,8-9H2,1-4H3/b13-12- |
| InChIKey | NNFTZVCRAFSARB-SEYXRHQNSA-N |
| XLogP | 5.02 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|