C26H25NO5 — CID 154251055
1-(4-hydroxyphenyl)-3-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one (PubChem CID 154251055) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one.
| Compound Name | 1-(4-hydroxyphenyl)-3-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 154251055 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
| SMILES | COc1cc(C=Cc2ccc(NC=CC(=O)c3ccc(O)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25NO5/c1-30-24-16-19(17-25(31-2)26(24)32-3)5-4-18-6-10-21(11-7-18)27-15-14-23(29)20-8-12-22(28)13-9-20/h4-17,27-28H,1-3H3 |
| InChIKey | ASFLPKPRBSUKAQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|