C24H23NO5 — CID 126069091
(E)-3-(2-phenoxyanilino)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 126069091) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (E)-3-(2-phenoxyanilino)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-phenoxyanilino)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126069091 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (E)-3-(2-phenoxyanilino)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/Nc2ccccc2Oc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO5/c1-27-22-15-17(16-23(28-2)24(22)29-3)20(26)13-14-25-19-11-7-8-12-21(19)30-18-9-5-4-6-10-18/h4-16,25H,1-3H3/b14-13+ |
| InChIKey | ZJYZHLGJGNFWBK-BUHFOSPRSA-N |
| XLogP | 5.31 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|