C13H14NaO6 — CID 131885797
CID 131885797 (PubChem CID 131885797) has the molecular formula C13H14NaO6 and a molecular weight of 289.24 g/mol.
| Compound Name | CID 131885797 |
|---|---|
| PubChem CID | 131885797 |
| Molecular Formula | C13H14NaO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | — |
| SMILES | COc1cc(C(=O)/C=C/C(=O)O)cc(OC)c1OC.[Na] |
| InChI | InChI=1S/C13H14O6.Na/c1-17-10-6-8(9(14)4-5-12(15)16)7-11(18-2)13(10)19-3;/h4-7H,1-3H3,(H,15,16);/b5-4+; |
| InChIKey | KBHBSDOUQAOWQT-FXRZFVDSSA-N |
| XLogP | 1.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|