C25H21NO4 — CID 163359166
(E)-3-acridin-9-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 163359166) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (E)-3-acridin-9-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-acridin-9-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163359166 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (E)-3-acridin-9-yl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2c3ccccc3nc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C25H21NO4/c1-28-23-14-16(15-24(29-2)25(23)30-3)22(27)13-12-17-18-8-4-6-10-20(18)26-21-11-7-5-9-19(17)21/h4-15H,1-3H3/b13-12+ |
| InChIKey | PVPFCOOAQWSBKT-OUKQBFOZSA-N |
| XLogP | 5.31 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|