C23H21N3O4 — CID 3138565
N'-acridin-9-yl-3,4,5-trimethoxybenzohydrazide (PubChem CID 3138565) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N'-acridin-9-yl-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-acridin-9-yl-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 3138565 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N'-acridin-9-yl-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNc2c3ccccc3nc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O4/c1-28-19-12-14(13-20(29-2)22(19)30-3)23(27)26-25-21-15-8-4-6-10-17(15)24-18-11-7-5-9-16(18)21/h4-13H,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | CUCQDEWWIWYGFW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|