C22H23N3O5 — CID 122303589
N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3,4,5-trimethoxybenzamide (PubChem CID 122303589) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 122303589 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2c(C)nc(Oc3ccccc3)nc2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O5/c1-13-19(14(2)24-22(23-13)30-16-9-7-6-8-10-16)25-21(26)15-11-17(27-3)20(29-5)18(12-15)28-4/h6-12H,1-5H3,(H,25,26) |
| InChIKey | DHONYEBOELHWEL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |