C22H24N4O5 — CID 122303901
1-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 122303901) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 122303901 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2c(C)nc(Oc3ccccc3)nc2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N4O5/c1-13-19(14(2)24-22(23-13)31-16-9-7-6-8-10-16)26-21(27)25-15-11-17(28-3)20(30-5)18(12-15)29-4/h6-12H,1-5H3,(H2,25,26,27) |
| InChIKey | MEQKMQSTPCPQFB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |