C23H26N4O2 — CID 122303902
1-(4-tert-butylphenyl)-3-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)urea (PubChem CID 122303902) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122303902 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)urea |
| SMILES | Cc1nc(Oc2ccccc2)nc(C)c1NC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-15-20(16(2)25-22(24-15)29-19-9-7-6-8-10-19)27-21(28)26-18-13-11-17(12-14-18)23(3,4)5/h6-14H,1-5H3,(H2,26,27,28) |
| InChIKey | DANUJLMRXZKTMI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |