C19H24N2O — CID 108884885
1-(4-tert-butylphenyl)-3-(2,6-dimethylphenyl)urea (PubChem CID 108884885) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108884885 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O/c1-13-7-6-8-14(2)17(13)21-18(22)20-16-11-9-15(10-12-16)19(3,4)5/h6-12H,1-5H3,(H2,20,21,22) |
| InChIKey | FGBXMIOMXKBKEE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |