C18H21ClN2O — CID 108884728
1-(4-tert-butylphenyl)-3-(3-chloro-4-methylphenyl)urea (PubChem CID 108884728) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 108884728 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O/c1-12-5-8-15(11-16(12)19)21-17(22)20-14-9-6-13(7-10-14)18(2,3)4/h5-11H,1-4H3,(H2,20,21,22) |
| InChIKey | WZSKAESVAHLEDR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |