C16H18ClN3O3S — CID 55910837
1-(3-chloro-4-methylphenyl)-3-[4-(ethylsulfonylamino)phenyl]urea (PubChem CID 55910837) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-(ethylsulfonylamino)phenyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-(ethylsulfonylamino)phenyl]urea |
|---|---|
| PubChem CID | 55910837 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-(ethylsulfonylamino)phenyl]urea |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)Nc2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-3-24(22,23)20-13-8-6-12(7-9-13)18-16(21)19-14-5-4-11(2)15(17)10-14/h4-10,20H,3H2,1-2H3,(H2,18,19,21) |
| InChIKey | WXQFGHGQUJMVMF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |