C20H17ClN2O — CID 108866984
1-(3-chloro-4-methylphenyl)-3-(4-phenylphenyl)urea (PubChem CID 108866984) has the molecular formula C20H17ClN2O and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(4-phenylphenyl)urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 108866984 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(4-phenylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C20H17ClN2O/c1-14-7-10-18(13-19(14)21)23-20(24)22-17-11-8-16(9-12-17)15-5-3-2-4-6-15/h2-13H,1H3,(H2,22,23,24) |
| InChIKey | CCGHBMMRCXHAFD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |