C21H19ClN2O — CID 23987254
1-[(3-chloro-4-methylphenyl)methyl]-3-(4-phenylphenyl)urea (PubChem CID 23987254) has the molecular formula C21H19ClN2O and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[(3-chloro-4-methylphenyl)methyl]-3-(4-phenylphenyl)urea.
| Compound Name | 1-[(3-chloro-4-methylphenyl)methyl]-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 23987254 |
| Molecular Formula | C21H19ClN2O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[(3-chloro-4-methylphenyl)methyl]-3-(4-phenylphenyl)urea |
| SMILES | Cc1ccc(CNC(=O)Nc2ccc(-c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C21H19ClN2O/c1-15-7-8-16(13-20(15)22)14-23-21(25)24-19-11-9-18(10-12-19)17-5-3-2-4-6-17/h2-13H,14H2,1H3,(H2,23,24,25) |
| InChIKey | IFGYBBVKTGFCRU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |