C16H14ClF3N2O2 — CID 3865446
1-(3-chloro-4-methylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3865446) has the molecular formula C16H14ClF3N2O2 and a molecular weight of 358.75 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3865446 |
| Molecular Formula | C16H14ClF3N2O2 |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2cccc(OC(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C16H14ClF3N2O2/c1-10-5-6-12(8-14(10)17)22-15(23)21-9-11-3-2-4-13(7-11)24-16(18,19)20/h2-8H,9H2,1H3,(H2,21,22,23) |
| InChIKey | SEINLIZSTYPFED-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |