C13H14F4N2O2 — CID 169150586
1-(3-fluorobut-3-enyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 169150586) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is 1-(3-fluorobut-3-enyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(3-fluorobut-3-enyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 169150586 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(3-fluorobut-3-enyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | C=C(F)CCNC(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F4N2O2/c1-9(14)5-6-18-12(20)19-8-10-3-2-4-11(7-10)21-13(15,16)17/h2-4,7H,1,5-6,8H2,(H2,18,19,20) |
| InChIKey | JZERZFBIKFJJHR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |