C18H16F3NO3 — CID 160603297
2-oxo-4-phenyl-N-[[3-(trifluoromethoxy)phenyl]methyl]butanamide (PubChem CID 160603297) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-oxo-4-phenyl-N-[[3-(trifluoromethoxy)phenyl]methyl]butanamide.
| Compound Name | 2-oxo-4-phenyl-N-[[3-(trifluoromethoxy)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 160603297 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-oxo-4-phenyl-N-[[3-(trifluoromethoxy)phenyl]methyl]butanamide |
| SMILES | O=C(CCc1ccccc1)C(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3NO3/c19-18(20,21)25-15-8-4-7-14(11-15)12-22-17(24)16(23)10-9-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,22,24) |
| InChIKey | XROXUVDZASCCLK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|