C14H14F6N2O2 — CID 169150598
1-[[3-(trifluoromethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea (PubChem CID 169150598) has the molecular formula C14H14F6N2O2 and a molecular weight of 356.27 g/mol. Its IUPAC name is 1-[[3-(trifluoromethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea.
| Compound Name | 1-[[3-(trifluoromethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea |
|---|---|
| PubChem CID | 169150598 |
| Molecular Formula | C14H14F6N2O2 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[[3-(trifluoromethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea |
| SMILES | C=C(CCNC(=O)NCc1cccc(OC(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C14H14F6N2O2/c1-9(13(15,16)17)5-6-21-12(23)22-8-10-3-2-4-11(7-10)24-14(18,19)20/h2-4,7H,1,5-6,8H2,(H2,21,22,23) |
| InChIKey | HRCPBZDDICKQHH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|