C16H20F3NO3 — CID 170199403
hept-6-enyl N-[[3-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 170199403) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is hept-6-enyl N-[[3-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | hept-6-enyl N-[[3-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170199403 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | hept-6-enyl N-[[3-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | C=CCCCCCOC(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NO3/c1-2-3-4-5-6-10-22-15(21)20-12-13-8-7-9-14(11-13)23-16(17,18)19/h2,7-9,11H,1,3-6,10,12H2,(H,20,21) |
| InChIKey | HWIIJJRPKUACCN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|