C28H25F6NO4 — CID 59192919
but-3-enyl N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]carbamate (PubChem CID 59192919) has the molecular formula C28H25F6NO4 and a molecular weight of 553.50 g/mol. Its IUPAC name is but-3-enyl N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]carbamate.
| Compound Name | but-3-enyl N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59192919 |
| Molecular Formula | C28H25F6NO4 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | but-3-enyl N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]carbamate |
| SMILES | C=CCCOC(=O)NCC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F6NO4/c1-2-3-15-37-25(36)35-19-26(18-20-9-5-4-6-10-20,21-11-7-13-23(16-21)38-27(29,30)31)22-12-8-14-24(17-22)39-28(32,33)34/h2,4-14,16-17H,1,3,15,18-19H2,(H,35,36) |
| InChIKey | JIKNSXHEHCFMAB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|