C27H20F6N2O4 — CID 59192843
N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]-1,2-oxazole-5-carboxamide (PubChem CID 59192843) has the molecular formula C27H20F6N2O4 and a molecular weight of 550.46 g/mol. Its IUPAC name is N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 59192843 |
| Molecular Formula | C27H20F6N2O4 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1)c1ccno1 |
| InChI | InChI=1S/C27H20F6N2O4/c28-26(29,30)37-21-10-4-8-19(14-21)25(16-18-6-2-1-3-7-18,17-34-24(36)23-12-13-35-39-23)20-9-5-11-22(15-20)38-27(31,32)33/h1-15H,16-17H2,(H,34,36) |
| InChIKey | ULBOVWKTWZMDGI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |