C31H25F6NO5S — CID 89266000
4-methylsulfonyl-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]benzamide (PubChem CID 89266000) has the molecular formula C31H25F6NO5S and a molecular weight of 637.60 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]benzamide |
|---|---|
| PubChem CID | 89266000 |
| Molecular Formula | C31H25F6NO5S |
| Molecular Weight | 637.60 g/mol |
| Exact Mass | 637.14 |
| IUPAC Name | 4-methylsulfonyl-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCC(Cc2ccccc2)(c2cccc(OC(F)(F)F)c2)c2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C31H25F6NO5S/c1-44(40,41)27-15-13-22(14-16-27)28(39)38-20-29(19-21-7-3-2-4-8-21,23-9-5-11-25(17-23)42-30(32,33)34)24-10-6-12-26(18-24)43-31(35,36)37/h2-18H,19-20H2,1H3,(H,38,39) |
| InChIKey | CDJLUTBHLGFYMO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |