C29H28F6N2O3 — CID 59192651
1-cyclopentyl-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea (PubChem CID 59192651) has the molecular formula C29H28F6N2O3 and a molecular weight of 566.54 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea.
| Compound Name | 1-cyclopentyl-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea |
|---|---|
| PubChem CID | 59192651 |
| Molecular Formula | C29H28F6N2O3 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 1-cyclopentyl-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea |
| SMILES | O=C(NCC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1)NC1CCCC1 |
| InChI | InChI=1S/C29H28F6N2O3/c30-28(31,32)39-24-14-6-10-21(16-24)27(18-20-8-2-1-3-9-20,19-36-26(38)37-23-12-4-5-13-23)22-11-7-15-25(17-22)40-29(33,34)35/h1-3,6-11,14-17,23H,4-5,12-13,18-19H2,(H2,36,37,38) |
| InChIKey | RZVTVSXJUBSOKF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |