C28H24F6N2O5 — CID 72539575
1-(2-oxooxolan-3-yl)-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea (PubChem CID 72539575) has the molecular formula C28H24F6N2O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is 1-(2-oxooxolan-3-yl)-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea.
| Compound Name | 1-(2-oxooxolan-3-yl)-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea |
|---|---|
| PubChem CID | 72539575 |
| Molecular Formula | C28H24F6N2O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 1-(2-oxooxolan-3-yl)-3-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]urea |
| SMILES | O=C(NCC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1)NC1CCOC1=O |
| InChI | InChI=1S/C28H24F6N2O5/c29-27(30,31)40-21-10-4-8-19(14-21)26(16-18-6-2-1-3-7-18,17-35-25(38)36-23-12-13-39-24(23)37)20-9-5-11-22(15-20)41-28(32,33)34/h1-11,14-15,23H,12-13,16-17H2,(H2,35,36,38) |
| InChIKey | OXXWJTLUEQXWKY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |