C26H22F4IN3O4 — CID 88975007
1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(3S)-2-oxooxolan-3-yl]urea (PubChem CID 88975007) has the molecular formula C26H22F4IN3O4 and a molecular weight of 643.38 g/mol. Its IUPAC name is 1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(3S)-2-oxooxolan-3-yl]urea.
| Compound Name | 1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(3S)-2-oxooxolan-3-yl]urea |
|---|---|
| PubChem CID | 88975007 |
| Molecular Formula | C26H22F4IN3O4 |
| Molecular Weight | 643.38 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | 1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(3S)-2-oxooxolan-3-yl]urea |
| SMILES | O=C(N[C@H]1CCOC1=O)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(I)cn1 |
| InChI | InChI=1S/C26H22F4IN3O4/c27-23(28)26(29,30)38-19-8-4-7-17(13-19)25(14-16-5-2-1-3-6-16,21-10-9-18(31)15-32-21)34-24(36)33-20-11-12-37-22(20)35/h1-10,13,15,20,23H,11-12,14H2,(H2,33,34,36)/t20-,25-/m0/s1 |
| InChIKey | WMYYLMDPJIQYAP-CPJSRVTESA-N |
| XLogP | 5.02 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|