C25H17F7IN5O2S — CID 88974893
1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 88974893) has the molecular formula C25H17F7IN5O2S and a molecular weight of 711.40 g/mol. Its IUPAC name is 1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 88974893 |
| Molecular Formula | C25H17F7IN5O2S |
| Molecular Weight | 711.40 g/mol |
| Exact Mass | 711.00 |
| IUPAC Name | 1-[(1S)-1-(5-iodo-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1nnc(C(F)(F)F)s1)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(I)cn1 |
| InChI | InChI=1S/C25H17F7IN5O2S/c26-19(27)25(31,32)40-17-8-4-7-15(11-17)23(12-14-5-2-1-3-6-14,18-10-9-16(33)13-34-18)36-21(39)35-22-38-37-20(41-22)24(28,29)30/h1-11,13,19H,12H2,(H2,35,36,38,39)/t23-/m0/s1 |
| InChIKey | LSLGFDWRGNZPRG-QHCPKHFHSA-N |
| XLogP | 7.10 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|