C30H24F4IN3O4 — CID 89347681
4-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid (PubChem CID 89347681) has the molecular formula C30H24F4IN3O4 and a molecular weight of 693.44 g/mol. Its IUPAC name is 4-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid.
| Compound Name | 4-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 89347681 |
| Molecular Formula | C30H24F4IN3O4 |
| Molecular Weight | 693.44 g/mol |
| Exact Mass | 693.07 |
| IUPAC Name | 4-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C30H24F4IN3O4/c31-27(32)30(33,34)42-24-8-4-7-22(15-24)29(16-19-5-2-1-3-6-19,25-14-9-20(17-35)18-36-25)38-28(41)37-23-12-10-21(11-13-23)26(39)40/h1-15,18,27H,16-17H2,(H,39,40)(H2,37,38,41)/t29-/m0/s1 |
| InChIKey | GCFMWWYDECSZKR-LJAQVGFWSA-N |
| XLogP | 7.26 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.44 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|