C26H22F4IN5O3 — CID 89347682
1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea (PubChem CID 89347682) has the molecular formula C26H22F4IN5O3 and a molecular weight of 655.39 g/mol. Its IUPAC name is 1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea.
| Compound Name | 1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea |
|---|---|
| PubChem CID | 89347682 |
| Molecular Formula | C26H22F4IN5O3 |
| Molecular Weight | 655.39 g/mol |
| Exact Mass | 655.07 |
| IUPAC Name | 1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea |
| SMILES | Cc1nnc(NC(=O)N[C@@](Cc2ccccc2)(c2cccc(OC(F)(F)C(F)F)c2)c2ccc(CI)cn2)o1 |
| InChI | InChI=1S/C26H22F4IN5O3/c1-16-35-36-24(38-16)33-23(37)34-25(13-17-6-3-2-4-7-17,21-11-10-18(14-31)15-32-21)19-8-5-9-20(12-19)39-26(29,30)22(27)28/h2-12,15,22H,13-14H2,1H3,(H2,33,34,36,37)/t25-/m0/s1 |
| InChIKey | PDXQONDCXMUVKV-VWLOTQADSA-N |
| XLogP | 6.25 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|