C29H28F4IN3O4 — CID 89347549
cis-(1S,2R)-2-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]cyclopentane-1-carboxylic acid (PubChem CID 89347549) has the molecular formula C29H28F4IN3O4 and a molecular weight of 685.46 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 89347549 |
| Molecular Formula | C29H28F4IN3O4 |
| Molecular Weight | 685.46 g/mol |
| Exact Mass | 685.11 |
| IUPAC Name | cis-(1S,2R)-2-[[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1C(=O)O)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C29H28F4IN3O4/c30-26(31)29(32,33)41-21-9-4-8-20(14-21)28(15-18-6-2-1-3-7-18,24-13-12-19(16-34)17-35-24)37-27(40)36-23-11-5-10-22(23)25(38)39/h1-4,6-9,12-14,17,22-23,26H,5,10-11,15-16H2,(H,38,39)(H2,36,37,40)/t22-,23+,28-/m0/s1 |
| InChIKey | GCSKIKSTSLRVOD-JWZKTCGFSA-N |
| XLogP | 6.29 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|