C34H32ClF4N3O2 — CID 58920905
3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-cyclohexyl-1-phenylurea (PubChem CID 58920905) has the molecular formula C34H32ClF4N3O2 and a molecular weight of 626.09 g/mol. Its IUPAC name is 3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-cyclohexyl-1-phenylurea.
| Compound Name | 3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-cyclohexyl-1-phenylurea |
|---|---|
| PubChem CID | 58920905 |
| Molecular Formula | C34H32ClF4N3O2 |
| Molecular Weight | 626.09 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | 3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-cyclohexyl-1-phenylurea |
| SMILES | O=C(N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C34H32ClF4N3O2/c35-26-19-20-30(40-23-26)33(22-24-11-4-1-5-12-24,25-13-10-18-29(21-25)44-34(38,39)31(36)37)41-32(43)42(27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-2,4-7,10-15,18-21,23,28,31H,3,8-9,16-17,22H2,(H,41,43)/t33-/m0/s1 |
| InChIKey | JVRHAKHKKVPUCM-XIFFEERXSA-N |
| XLogP | 9.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.09 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|