C30H26ClF4N3O4 — CID 58920258
(1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 58920258) has the molecular formula C30H26ClF4N3O4 and a molecular weight of 604.00 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 58920258 |
| Molecular Formula | C30H26ClF4N3O4 |
| Molecular Weight | 604.00 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(N[C@@H]1[C@H](C(=O)O)[C@H]2C=C[C@@H]1C2)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C30H26ClF4N3O4/c31-21-11-12-23(36-16-21)29(15-17-5-2-1-3-6-17,20-7-4-8-22(14-20)42-30(34,35)27(32)33)38-28(41)37-25-19-10-9-18(13-19)24(25)26(39)40/h1-12,14,16,18-19,24-25,27H,13,15H2,(H,39,40)(H2,37,38,41)/t18-,19+,24+,25-,29-/m0/s1 |
| InChIKey | GCKLLFHXGNAWPJ-AQVKDHCBSA-N |
| XLogP | 6.03 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.00 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|