C29H28ClF4N3O2 — CID 16740040
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]urea (PubChem CID 16740040) has the molecular formula C29H28ClF4N3O2 and a molecular weight of 562.01 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]urea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 16740040 |
| Molecular Formula | C29H28ClF4N3O2 |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]urea |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1C2)N[C@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C29H28ClF4N3O2/c30-22-11-12-25(35-17-22)28(16-18-5-2-1-3-6-18,37-27(38)36-24-14-19-9-10-20(24)13-19)21-7-4-8-23(15-21)39-29(33,34)26(31)32/h1-8,11-12,15,17,19-20,24,26H,9-10,13-14,16H2,(H2,36,37,38)/t19-,20+,24+,28+/m0/s1 |
| InChIKey | UEZCKTCRGMSIJJ-CCLQIUPMSA-N |
| XLogP | 6.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|