C32H32ClF4N3O4 — CID 89340761
ethyl (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 89340761) has the molecular formula C32H32ClF4N3O4 and a molecular weight of 634.07 g/mol. Its IUPAC name is ethyl (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89340761 |
| Molecular Formula | C32H32ClF4N3O4 |
| Molecular Weight | 634.07 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | ethyl (1R,2R,3S,4S)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1NC(=O)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C32H32ClF4N3O4/c1-2-43-28(41)26-20-11-12-21(15-20)27(26)39-30(42)40-31(17-19-7-4-3-5-8-19,25-14-13-23(33)18-38-25)22-9-6-10-24(16-22)44-32(36,37)29(34)35/h3-10,13-14,16,18,20-21,26-27,29H,2,11-12,15,17H2,1H3,(H2,39,40,42)/t20-,21+,26-,27+,31+/m1/s1 |
| InChIKey | UNOMRNGAUKJIEH-GQPASCPRSA-N |
| XLogP | 6.74 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.07 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|