C28H28ClF4N3O2 — CID 58920207
N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]azepane-1-carboxamide (PubChem CID 58920207) has the molecular formula C28H28ClF4N3O2 and a molecular weight of 550.00 g/mol. Its IUPAC name is N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]azepane-1-carboxamide.
| Compound Name | N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 58920207 |
| Molecular Formula | C28H28ClF4N3O2 |
| Molecular Weight | 550.00 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]azepane-1-carboxamide |
| SMILES | O=C(N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)N1CCCCCC1 |
| InChI | InChI=1S/C28H28ClF4N3O2/c29-22-13-14-24(34-19-22)27(18-20-9-4-3-5-10-20,35-26(37)36-15-6-1-2-7-16-36)21-11-8-12-23(17-21)38-28(32,33)25(30)31/h3-5,8-14,17,19,25H,1-2,6-7,15-16,18H2,(H,35,37)/t27-/m0/s1 |
| InChIKey | CSABGPIXHMKDAR-MHZLTWQESA-N |
| XLogP | 7.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.00 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|