C25H18Cl2F4N4O2S — CID 58920563
1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-chloro-1,3-thiazol-2-yl)urea (PubChem CID 58920563) has the molecular formula C25H18Cl2F4N4O2S and a molecular weight of 585.41 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-chloro-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-chloro-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 58920563 |
| Molecular Formula | C25H18Cl2F4N4O2S |
| Molecular Weight | 585.41 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-(5-chloro-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1ncc(Cl)s1)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H18Cl2F4N4O2S/c26-17-9-10-19(32-13-17)24(12-15-5-2-1-3-6-15,35-22(36)34-23-33-14-20(27)38-23)16-7-4-8-18(11-16)37-25(30,31)21(28)29/h1-11,13-14,21H,12H2,(H2,33,34,35,36)/t24-/m0/s1 |
| InChIKey | JNCNRJRFDXVANM-DEOSSOPVSA-N |
| XLogP | 7.39 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.41 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|