C32H23ClF4N2O3 — CID 58921168
naphthalen-2-yl N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate (PubChem CID 58921168) has the molecular formula C32H23ClF4N2O3 and a molecular weight of 594.99 g/mol. Its IUPAC name is naphthalen-2-yl N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate.
| Compound Name | naphthalen-2-yl N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 58921168 |
| Molecular Formula | C32H23ClF4N2O3 |
| Molecular Weight | 594.99 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | naphthalen-2-yl N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate |
| SMILES | O=C(N[C@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H23ClF4N2O3/c33-25-14-16-28(38-20-25)31(19-21-7-2-1-3-8-21,24-11-6-12-27(18-24)42-32(36,37)29(34)35)39-30(40)41-26-15-13-22-9-4-5-10-23(22)17-26/h1-18,20,29H,19H2,(H,39,40)/t31-/m1/s1 |
| InChIKey | SYZFIYAUTOJFTD-WJOKGBTCSA-N |
| XLogP | 8.40 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.99 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|