C32H35ClF4N2O3 — CID 58920526
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate (PubChem CID 58920526) has the molecular formula C32H35ClF4N2O3 and a molecular weight of 607.09 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 58920526 |
| Molecular Formula | C32H35ClF4N2O3 |
| Molecular Weight | 607.09 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C32H35ClF4N2O3/c1-20(2)26-14-12-21(3)16-27(26)41-30(40)39-31(18-22-8-5-4-6-9-22,28-15-13-24(33)19-38-28)23-10-7-11-25(17-23)42-32(36,37)29(34)35/h4-11,13,15,17,19-21,26-27,29H,12,14,16,18H2,1-3H3,(H,39,40)/t21-,26+,27-,31-/m0/s1 |
| InChIKey | OFQATWJERUBDSO-QBLGKZKTSA-N |
| XLogP | 8.65 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.09 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|