C30H25ClF4N4O3 — CID 16739927
N-[2-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]phenyl]acetamide (PubChem CID 16739927) has the molecular formula C30H25ClF4N4O3 and a molecular weight of 601.00 g/mol. Its IUPAC name is N-[2-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]phenyl]acetamide.
| Compound Name | N-[2-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 16739927 |
| Molecular Formula | C30H25ClF4N4O3 |
| Molecular Weight | 601.00 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | N-[2-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1NC(=O)N[C@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C30H25ClF4N4O3/c1-19(40)37-24-12-5-6-13-25(24)38-28(41)39-29(17-20-8-3-2-4-9-20,26-15-14-22(31)18-36-26)21-10-7-11-23(16-21)42-30(34,35)27(32)33/h2-16,18,27H,17H2,1H3,(H,37,40)(H2,38,39,41)/t29-/m1/s1 |
| InChIKey | KQDSBPDVXXOTPU-GDLZYMKVSA-N |
| XLogP | 7.24 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.00 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|