C25H21ClF4N2O2 — CID 58921375
N-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]cyclopropanecarboxamide (PubChem CID 58921375) has the molecular formula C25H21ClF4N2O2 and a molecular weight of 492.90 g/mol. Its IUPAC name is N-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 58921375 |
| Molecular Formula | C25H21ClF4N2O2 |
| Molecular Weight | 492.90 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NC(Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)C1CC1 |
| InChI | InChI=1S/C25H21ClF4N2O2/c26-19-11-12-21(31-15-19)24(32-22(33)17-9-10-17,14-16-5-2-1-3-6-16)18-7-4-8-20(13-18)34-25(29,30)23(27)28/h1-8,11-13,15,17,23H,9-10,14H2,(H,32,33) |
| InChIKey | PBVBHYNWHIRCFC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.90 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|