C29H21ClF7N3O3 — CID 58920086
1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 58920086) has the molecular formula C29H21ClF7N3O3 and a molecular weight of 627.94 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 58920086 |
| Molecular Formula | C29H21ClF7N3O3 |
| Molecular Weight | 627.94 g/mol |
| Exact Mass | 627.12 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C29H21ClF7N3O3/c30-20-12-13-24(38-17-20)27(16-18-6-2-1-3-7-18,19-8-4-10-22(14-19)42-28(33,34)25(31)32)40-26(41)39-21-9-5-11-23(15-21)43-29(35,36)37/h1-15,17,25H,16H2,(H2,39,40,41)/t27-/m0/s1 |
| InChIKey | UFJSNCTXKQLWTM-MHZLTWQESA-N |
| XLogP | 8.18 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.94 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|