C27H26ClF4N3O2 — CID 58920821
1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-cyclopentylurea (PubChem CID 58920821) has the molecular formula C27H26ClF4N3O2 and a molecular weight of 535.97 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-cyclopentylurea.
| Compound Name | 1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 58920821 |
| Molecular Formula | C27H26ClF4N3O2 |
| Molecular Weight | 535.97 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-cyclopentylurea |
| SMILES | O=C(NC1CCCC1)NC(Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C27H26ClF4N3O2/c28-20-13-14-23(33-17-20)26(16-18-7-2-1-3-8-18,35-25(36)34-21-10-4-5-11-21)19-9-6-12-22(15-19)37-27(31,32)24(29)30/h1-3,6-9,12-15,17,21,24H,4-5,10-11,16H2,(H2,34,35,36) |
| InChIKey | PCDFFALJFNFSEX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.97 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|