C31H25ClF4N4O2 — CID 58921463
3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-(2-cyanoethyl)-1-phenylurea (PubChem CID 58921463) has the molecular formula C31H25ClF4N4O2 and a molecular weight of 597.01 g/mol. Its IUPAC name is 3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-(2-cyanoethyl)-1-phenylurea.
| Compound Name | 3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-(2-cyanoethyl)-1-phenylurea |
|---|---|
| PubChem CID | 58921463 |
| Molecular Formula | C31H25ClF4N4O2 |
| Molecular Weight | 597.01 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 3-[(1S)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-1-(2-cyanoethyl)-1-phenylurea |
| SMILES | N#CCCN(C(=O)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)c1ccccc1 |
| InChI | InChI=1S/C31H25ClF4N4O2/c32-24-15-16-27(38-21-24)30(20-22-9-3-1-4-10-22,23-11-7-14-26(19-23)42-31(35,36)28(33)34)39-29(41)40(18-8-17-37)25-12-5-2-6-13-25/h1-7,9-16,19,21,28H,8,18,20H2,(H,39,41)/t30-/m0/s1 |
| InChIKey | NQJQKKFDBAHVPZ-PMERELPUSA-N |
| XLogP | 7.59 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.01 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|