C34H31ClF5N3O3 — CID 58919939
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(1R,2R)-2-phenylmethoxycyclopentyl]urea (PubChem CID 58919939) has the molecular formula C34H31ClF5N3O3 and a molecular weight of 660.08 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(1R,2R)-2-phenylmethoxycyclopentyl]urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(1R,2R)-2-phenylmethoxycyclopentyl]urea |
|---|---|
| PubChem CID | 58919939 |
| Molecular Formula | C34H31ClF5N3O3 |
| Molecular Weight | 660.08 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(1R,2R)-2-phenylmethoxycyclopentyl]urea |
| SMILES | O=C(N[C@@H]1CCC[C@H]1OCc1ccccc1)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C34H31ClF5N3O3/c35-25-14-15-30(41-20-25)33(19-22-8-3-1-4-9-22,24-16-26(36)18-27(17-24)46-34(39,40)31(37)38)43-32(44)42-28-12-7-13-29(28)45-21-23-10-5-2-6-11-23/h1-6,8-11,14-18,20,28-29,31H,7,12-13,19,21H2,(H2,42,43,44)/t28-,29-,33+/m1/s1 |
| InChIKey | FFBDFNLCHCQVPZ-JBKHTMJZSA-N |
| XLogP | 8.03 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.08 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|