C31H30ClF5N4O4 — CID 58921312
cis-(1S,3R)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(2-oxopropyl)cyclopentane-1-carboxamide (PubChem CID 58921312) has the molecular formula C31H30ClF5N4O4 and a molecular weight of 653.05 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(2-oxopropyl)cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(2-oxopropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 58921312 |
| Molecular Formula | C31H30ClF5N4O4 |
| Molecular Weight | 653.05 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | cis-(1S,3R)-3-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(2-oxopropyl)cyclopentane-1-carboxamide |
| SMILES | CC(=O)CNC(=O)[C@H]1CC[C@@H](NC(=O)N[C@@](Cc2ccccc2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C31H30ClF5N4O4/c1-18(42)16-39-27(43)20-7-9-24(11-20)40-29(44)41-30(15-19-5-3-2-4-6-19,26-10-8-22(32)17-38-26)21-12-23(33)14-25(13-21)45-31(36,37)28(34)35/h2-6,8,10,12-14,17,20,24,28H,7,9,11,15-16H2,1H3,(H,39,43)(H2,40,41,44)/t20-,24+,30-/m0/s1 |
| InChIKey | NSPLQOSHHTYRHV-AJUGZHKCSA-N |
| XLogP | 5.77 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.05 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|