C25H17ClF11N3O2 — CID 58921717
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea (PubChem CID 58921717) has the molecular formula C25H17ClF11N3O2 and a molecular weight of 635.86 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
|---|---|
| PubChem CID | 58921717 |
| Molecular Formula | C25H17ClF11N3O2 |
| Molecular Weight | 635.86 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
| SMILES | O=C(NC(C(F)(F)F)C(F)(F)F)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H17ClF11N3O2/c26-15-6-7-18(38-12-15)22(11-13-4-2-1-3-5-13,40-21(41)39-19(23(30,31)32)24(33,34)35)14-8-16(27)10-17(9-14)42-25(36,37)20(28)29/h1-10,12,19-20H,11H2,(H2,39,40,41)/t22-/m0/s1 |
| InChIKey | RMURZSRCUIWPQB-QFIPXVFZSA-N |
| XLogP | 7.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.86 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|