C25H18ClF11N2O2 — CID 58920343
2-[[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58920343) has the molecular formula C25H18ClF11N2O2 and a molecular weight of 622.86 g/mol. Its IUPAC name is 2-[[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58920343 |
| Molecular Formula | C25H18ClF11N2O2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | 2-[[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(CN[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H18ClF11N2O2/c26-16-6-7-19(38-12-16)21(11-14-4-2-1-3-5-14,39-13-22(40,24(32,33)34)25(35,36)37)15-8-17(27)10-18(9-15)41-23(30,31)20(28)29/h1-10,12,20,39-40H,11,13H2/t21-/m0/s1 |
| InChIKey | HVDWFUVOSSLMLK-NRFANRHFSA-N |
| XLogP | 7.04 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|