C25H21ClF8N2O2 — CID 24956464
(2S)-3-[[(2R)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-phenylpropyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 24956464) has the molecular formula C25H21ClF8N2O2 and a molecular weight of 568.89 g/mol. Its IUPAC name is (2S)-3-[[(2R)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-phenylpropyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[[(2R)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-phenylpropyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24956464 |
| Molecular Formula | C25H21ClF8N2O2 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | (2S)-3-[[(2R)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-phenylpropyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@@H](CNC[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)C(F)(F)F |
| InChI | InChI=1S/C25H21ClF8N2O2/c26-17-6-7-20(36-12-17)23(11-15-4-2-1-3-5-15,14-35-13-21(37)24(30,31)32)16-8-18(27)10-19(9-16)38-25(33,34)22(28)29/h1-10,12,21-22,35,37H,11,13-14H2/t21-,23-/m0/s1 |
| InChIKey | WPWXSAZBPXWZGR-GMAHTHKFSA-N |
| XLogP | 6.15 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|