C26H21F10NO3 — CID 59459472
(2R)-3-[[(1R)-1-[4-(difluoromethoxy)phenyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 59459472) has the molecular formula C26H21F10NO3 and a molecular weight of 585.44 g/mol. Its IUPAC name is (2R)-3-[[(1R)-1-[4-(difluoromethoxy)phenyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-[[(1R)-1-[4-(difluoromethoxy)phenyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 59459472 |
| Molecular Formula | C26H21F10NO3 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | (2R)-3-[[(1R)-1-[4-(difluoromethoxy)phenyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@H](CN[C@](Cc1ccccc1)(c1ccc(OC(F)F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C26H21F10NO3/c27-18-10-17(11-20(12-18)40-26(35,36)22(28)29)24(13-15-4-2-1-3-5-15,37-14-21(38)25(32,33)34)16-6-8-19(9-7-16)39-23(30)31/h1-12,21-23,37-38H,13-14H2/t21-,24-/m1/s1 |
| InChIKey | LCORRYCDIHQUGQ-ZJSXRUAMSA-N |
| XLogP | 6.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|